C24H18F2N6O3 — CID 68663996
1-N'-(4-fluorophenyl)-1-N'-[2-fluoro-4-[[2-(2H-triazol-4-yl)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 68663996) has the molecular formula C24H18F2N6O3 and a molecular weight of 476.44 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N'-[2-fluoro-4-[[2-(2H-triazol-4-yl)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N'-[2-fluoro-4-[[2-(2H-triazol-4-yl)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 68663996 |
| Molecular Formula | C24H18F2N6O3 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N'-[2-fluoro-4-[[2-(2H-triazol-4-yl)-4-pyridinyl]oxy]phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N(c2ccc(F)cc2)c2ccc(Oc3ccnc(-c4cn[nH]n4)c3)cc2F)CC1 |
| InChI | InChI=1S/C24H18F2N6O3/c25-14-1-3-15(4-2-14)32(23(34)24(8-9-24)22(27)33)21-6-5-16(11-18(21)26)35-17-7-10-28-19(12-17)20-13-29-31-30-20/h1-7,10-13H,8-9H2,(H2,27,33)(H,29,30,31) |
| InChIKey | BNEJZMMOZOBZSL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|