C28H31ClFN5S — CID 68664716
2-N-[4-(1-benzothiophen-2-yl)-3-chlorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68664716) has the molecular formula C28H31ClFN5S and a molecular weight of 524.11 g/mol. Its IUPAC name is 2-N-[4-(1-benzothiophen-2-yl)-3-chlorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(1-benzothiophen-2-yl)-3-chlorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68664716 |
| Molecular Formula | C28H31ClFN5S |
| Molecular Weight | 524.11 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-N-[4-(1-benzothiophen-2-yl)-3-chlorophenyl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(-c4cc5ccccc5s4)c(Cl)c3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C28H31ClFN5S/c1-27(2)14-19(15-28(3,4)35(27)5)32-25-22(30)16-31-26(34-25)33-18-10-11-20(21(29)13-18)24-12-17-8-6-7-9-23(17)36-24/h6-13,16,19H,14-15H2,1-5H3,(H2,31,32,33,34) |
| InChIKey | IVAAKOPNKFFRIC-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.11 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |