About 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride
6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride (PubChem CID 68664900) has the molecular formula C14H18ClNO3S
and a molecular weight of 315.82 g/mol. Its IUPAC name is 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride.
Molecular Properties
| Compound Name | 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride |
| PubChem CID | 68664900 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride |
| SMILES | Cc1ccc2c(c1)C(=O)CC1(CCNCC1)S2(=O)=O.Cl |
| InChI | InChI=1S/C14H17NO3S.ClH/c1-10-2-3-13-11(8-10)12(16)9-14(19(13,17)18)4-6-15-7-5-14;/h2-3,8,15H,4-7,9H2,1H3;1H |
| InChIKey | FPESPYCMGIATRU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride?
The IUPAC name of 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride (CID 68664900) is 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride.
What is the SMILES notation for 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride?
The canonical SMILES for 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride is Cc1ccc2c(c1)C(=O)CC1(CCNCC1)S2(=O)=O.Cl.
What is the InChIKey of 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride?
The InChIKey is FPESPYCMGIATRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3S.ClH/c1-10-2-3-13-11(8-10)12(16)9-14(19(13,17)18)4-6-15-7-5-14;/h2-3,8,15H,4-7,9H2,1H3;1H.
What are the key properties of 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride?
6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride has a molecular weight of 315.82 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,1-dioxospiro[3H-thiochromene-2,4'-piperidine]-4-one;hydrochloride is sourced from PubChem (CID 68664900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).