C23H26F4N6O — CID 68664908
1-[4-[[5-fluoro-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pyrimidin-2-yl]amino]-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-yl]ethanone (PubChem CID 68664908) has the molecular formula C23H26F4N6O and a molecular weight of 478.49 g/mol. Its IUPAC name is 1-[4-[[5-fluoro-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pyrimidin-2-yl]amino]-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-yl]ethanone.
| Compound Name | 1-[4-[[5-fluoro-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pyrimidin-2-yl]amino]-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 68664908 |
| Molecular Formula | C23H26F4N6O |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 1-[4-[[5-fluoro-4-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]amino]pyrimidin-2-yl]amino]-11-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-trien-11-yl]ethanone |
| SMILES | CC(=O)N1C2CCC1c1cc(Nc3ncc(F)c(NC4CCN(CC(F)(F)F)CC4)n3)ccc12 |
| InChI | InChI=1S/C23H26F4N6O/c1-13(34)33-19-4-5-20(33)17-10-15(2-3-16(17)19)30-22-28-11-18(24)21(31-22)29-14-6-8-32(9-7-14)12-23(25,26)27/h2-3,10-11,14,19-20H,4-9,12H2,1H3,(H2,28,29,30,31) |
| InChIKey | AORNFFWLDGZALJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |