C23H32FN9O — CID 68665038
5-fluoro-2-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665038) has the molecular formula C23H32FN9O and a molecular weight of 469.57 g/mol. Its IUPAC name is 5-fluoro-2-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665038 |
| Molecular Formula | C23H32FN9O |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 5-fluoro-2-N-[3-methoxy-5-(5-methyltetrazol-1-yl)phenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)cc(-n2nnnc2C)c1 |
| InChI | InChI=1S/C23H32FN9O/c1-14-29-30-31-33(14)17-8-15(9-18(10-17)34-7)27-21-25-13-19(24)20(28-21)26-16-11-22(2,3)32(6)23(4,5)12-16/h8-10,13,16H,11-12H2,1-7H3,(H2,25,26,27,28) |
| InChIKey | YVROVJDTIQYIIT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |