C17H16F3N6O4P — CID 68665211
3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl dihydrogen phosphate (PubChem CID 68665211) has the molecular formula C17H16F3N6O4P and a molecular weight of 456.32 g/mol. Its IUPAC name is 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl dihydrogen phosphate.
| Compound Name | 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 68665211 |
| Molecular Formula | C17H16F3N6O4P |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCCNc1nc2cc(C(F)(F)F)ccc2n2c(-c3ccn[nH]3)cnc12 |
| InChI | InChI=1S/C17H16F3N6O4P/c18-17(19,20)10-2-3-13-12(8-10)24-15(21-5-1-7-30-31(27,28)29)16-22-9-14(26(13)16)11-4-6-23-25-11/h2-4,6,8-9H,1,5,7H2,(H,21,24)(H,23,25)(H2,27,28,29) |
| InChIKey | PMVSUMIEFMNYBW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|