C22H18F3N7O — CID 68665329
3-[[1-(1-phenyltriazol-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol (PubChem CID 68665329) has the molecular formula C22H18F3N7O and a molecular weight of 453.43 g/mol. Its IUPAC name is 3-[[1-(1-phenyltriazol-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[1-(1-phenyltriazol-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 68665329 |
| Molecular Formula | C22H18F3N7O |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 3-[[1-(1-phenyltriazol-4-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1nc2cc(C(F)(F)F)ccc2n2c(-c3cn(-c4ccccc4)nn3)cnc12 |
| InChI | InChI=1S/C22H18F3N7O/c23-22(24,25)14-7-8-18-16(11-14)28-20(26-9-4-10-33)21-27-12-19(32(18)21)17-13-31(30-29-17)15-5-2-1-3-6-15/h1-3,5-8,11-13,33H,4,9-10H2,(H,26,28) |
| InChIKey | ZVNGAWOOYIDDSP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|