C24H32F4N6O — CID 68665415
5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pyrimidine-2,4-diamine (PubChem CID 68665415) has the molecular formula C24H32F4N6O and a molecular weight of 496.55 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665415 |
| Molecular Formula | C24H32F4N6O |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 5-fluoro-2-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-N-(1,2,2,5,5-pentamethylpyrrolidin-3-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3ccc(N4CCOCC4)c(C(F)(F)F)c3)ncc2F)C1(C)C |
| InChI | InChI=1S/C24H32F4N6O/c1-22(2)13-19(23(3,4)33(22)5)31-20-17(25)14-29-21(32-20)30-15-6-7-18(16(12-15)24(26,27)28)34-8-10-35-11-9-34/h6-7,12,14,19H,8-11,13H2,1-5H3,(H2,29,30,31,32) |
| InChIKey | UCKHVALHHBHYTO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|