C31H28F3N6O4P — CID 68665437
1,2-diphenylethyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl hydrogen phosphate (PubChem CID 68665437) has the molecular formula C31H28F3N6O4P and a molecular weight of 636.57 g/mol. Its IUPAC name is 1,2-diphenylethyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl hydrogen phosphate.
| Compound Name | 1,2-diphenylethyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl hydrogen phosphate |
|---|---|
| PubChem CID | 68665437 |
| Molecular Formula | C31H28F3N6O4P |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | 1,2-diphenylethyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl hydrogen phosphate |
| SMILES | O=P(O)(OCCCNc1nc2cc(C(F)(F)F)ccc2n2c(-c3ccn[nH]3)cnc12)OC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28F3N6O4P/c32-31(33,34)23-12-13-26-25(19-23)38-29(30-36-20-27(40(26)30)24-14-16-37-39-24)35-15-7-17-43-45(41,42)44-28(22-10-5-2-6-11-22)18-21-8-3-1-4-9-21/h1-6,8-14,16,19-20,28H,7,15,17-18H2,(H,35,38)(H,37,39)(H,41,42) |
| InChIKey | HGROLIXXPRZPHI-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|