C25H32FN5O — CID 68665515
5-fluoro-2-N-[4-(furan-3-yl)-3-methylphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665515) has the molecular formula C25H32FN5O and a molecular weight of 437.56 g/mol. Its IUPAC name is 5-fluoro-2-N-[4-(furan-3-yl)-3-methylphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N-[4-(furan-3-yl)-3-methylphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665515 |
| Molecular Formula | C25H32FN5O |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 5-fluoro-2-N-[4-(furan-3-yl)-3-methylphenyl]-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncc(F)c(NC3CC(C)(C)N(C)C(C)(C)C3)n2)ccc1-c1ccoc1 |
| InChI | InChI=1S/C25H32FN5O/c1-16-11-18(7-8-20(16)17-9-10-32-15-17)29-23-27-14-21(26)22(30-23)28-19-12-24(2,3)31(6)25(4,5)13-19/h7-11,14-15,19H,12-13H2,1-6H3,(H2,27,28,29,30) |
| InChIKey | LBOOLSLGLUPMBX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |