C9H11NO2 — CID 68665545
4a,5,6,8a-tetrahydro-1H-quinoline-2,4-dione (PubChem CID 68665545) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 4a,5,6,8a-tetrahydro-1H-quinoline-2,4-dione.
| Compound Name | 4a,5,6,8a-tetrahydro-1H-quinoline-2,4-dione |
|---|---|
| PubChem CID | 68665545 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4a,5,6,8a-tetrahydro-1H-quinoline-2,4-dione |
| SMILES | O=C1CC(=O)C2CCC=CC2N1 |
| InChI | InChI=1S/C9H11NO2/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h2,4,6-7H,1,3,5H2,(H,10,12) |
| InChIKey | JXBCEQPBDBBQLD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|