C23H32FN5 — CID 68665836
2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine (PubChem CID 68665836) has the molecular formula C23H32FN5 and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68665836 |
| Molecular Formula | C23H32FN5 |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(Nc2nc(N[C@@H]3CCc4ccccc43)ncc2F)CC1(C)C |
| InChI | InChI=1S/C23H32FN5/c1-22(2)12-16(13-23(3,4)29(22)5)26-20-18(24)14-25-21(28-20)27-19-11-10-15-8-6-7-9-17(15)19/h6-9,14,16,19H,10-13H2,1-5H3,(H2,25,26,27,28)/t19-/m1/s1 |
| InChIKey | XMVGBSOTOPLJKU-LJQANCHMSA-N |
| XLogP | 4.78 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |