C35H40FN5O2 — CID 68666220
2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-[(4-phenylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 68666220) has the molecular formula C35H40FN5O2 and a molecular weight of 581.74 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-[(4-phenylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-[(4-phenylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 68666220 |
| Molecular Formula | C35H40FN5O2 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-4-N-[(4-phenylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CN1C(C)(C)CC(N(Cc2ccc(-c3ccccc3)cc2)c2nc(Nc3ccc4c(c3)OCCO4)ncc2F)CC1(C)C |
| InChI | InChI=1S/C35H40FN5O2/c1-34(2)20-28(21-35(3,4)40(34)5)41(23-24-11-13-26(14-12-24)25-9-7-6-8-10-25)32-29(36)22-37-33(39-32)38-27-15-16-30-31(19-27)43-18-17-42-30/h6-16,19,22,28H,17-18,20-21,23H2,1-5H3,(H,37,38,39) |
| InChIKey | REQLUZYXUFTHTF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |