C25H35FN6O — CID 68666420
1-ethyl-6-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-3,4-dihydroquinolin-2-one (PubChem CID 68666420) has the molecular formula C25H35FN6O and a molecular weight of 454.59 g/mol. Its IUPAC name is 1-ethyl-6-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-ethyl-6-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 68666420 |
| Molecular Formula | C25H35FN6O |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 1-ethyl-6-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-3,4-dihydroquinolin-2-one |
| SMILES | CCN1C(=O)CCc2cc(Nc3ncc(F)c(NC4CC(C)(C)N(C)C(C)(C)C4)n3)ccc21 |
| InChI | InChI=1S/C25H35FN6O/c1-7-32-20-10-9-17(12-16(20)8-11-21(32)33)29-23-27-15-19(26)22(30-23)28-18-13-24(2,3)31(6)25(4,5)14-18/h9-10,12,15,18H,7-8,11,13-14H2,1-6H3,(H2,27,28,29,30) |
| InChIKey | ZBCCDWYUIURVCL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |