C20H18Cl2N6 — CID 68667695
1,1-bis[3-(4-chlorophenyl)-1H-pyrazol-5-yl]ethane-1,2-diamine (PubChem CID 68667695) has the molecular formula C20H18Cl2N6 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1,1-bis[3-(4-chlorophenyl)-1H-pyrazol-5-yl]ethane-1,2-diamine.
| Compound Name | 1,1-bis[3-(4-chlorophenyl)-1H-pyrazol-5-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 68667695 |
| Molecular Formula | C20H18Cl2N6 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1,1-bis[3-(4-chlorophenyl)-1H-pyrazol-5-yl]ethane-1,2-diamine |
| SMILES | NCC(N)(c1cc(-c2ccc(Cl)cc2)n[nH]1)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C20H18Cl2N6/c21-14-5-1-12(2-6-14)16-9-18(27-25-16)20(24,11-23)19-10-17(26-28-19)13-3-7-15(22)8-4-13/h1-10H,11,23-24H2,(H,25,27)(H,26,28) |
| InChIKey | ZSWFAAFASDXSSZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |