C41H38F3N3O2 — CID 68668071
3-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-2,2-dimethylpropan-1-ol (PubChem CID 68668071) has the molecular formula C41H38F3N3O2 and a molecular weight of 661.77 g/mol. Its IUPAC name is 3-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 68668071 |
| Molecular Formula | C41H38F3N3O2 |
| Molecular Weight | 661.77 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | 3-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c(CC(O)(c2ccc(-c3ccc(F)cn3)cc2)C(F)F)n1 |
| InChI | InChI=1S/C41H38F3N3O2/c1-39(2,28-48)24-35-27-47(41(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33)37(46-35)25-40(49,38(43)44)30-20-18-29(19-21-30)36-23-22-34(42)26-45-36/h3-23,26-27,38,48-49H,24-25,28H2,1-2H3 |
| InChIKey | UJAPHRPKZCVMHC-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.77 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|