C42H40F3N3O3 — CID 68668307
4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-3,3-dimethylbutane-1,2-diol (PubChem CID 68668307) has the molecular formula C42H40F3N3O3 and a molecular weight of 691.79 g/mol. Its IUPAC name is 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-3,3-dimethylbutane-1,2-diol.
| Compound Name | 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-3,3-dimethylbutane-1,2-diol |
|---|---|
| PubChem CID | 68668307 |
| Molecular Formula | C42H40F3N3O3 |
| Molecular Weight | 691.79 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | 4-[2-[3,3-difluoro-2-[4-(5-fluoro-2-pyridinyl)phenyl]-2-hydroxypropyl]-1-tritylimidazol-4-yl]-3,3-dimethylbutane-1,2-diol |
| SMILES | CC(C)(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c(CC(O)(c2ccc(-c3ccc(F)cn3)cc2)C(F)F)n1)C(O)CO |
| InChI | InChI=1S/C42H40F3N3O3/c1-40(2,37(50)28-49)24-35-27-48(42(31-12-6-3-7-13-31,32-14-8-4-9-15-32)33-16-10-5-11-17-33)38(47-35)25-41(51,39(44)45)30-20-18-29(19-21-30)36-23-22-34(43)26-46-36/h3-23,26-27,37,39,49-51H,24-25,28H2,1-2H3 |
| InChIKey | STENVCCAYSDSGE-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.79 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|