C30H35N3O3 — CID 68669015
N-[1-[2-[3-(2-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-2-phenylethyl]acetamide (PubChem CID 68669015) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[1-[2-[3-(2-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-2-phenylethyl]acetamide.
| Compound Name | N-[1-[2-[3-(2-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 68669015 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-[1-[2-[3-(2-benzylpiperazin-1-yl)-3-oxopropyl]phenoxy]-2-phenylethyl]acetamide |
| SMILES | CC(=O)NC(Cc1ccccc1)Oc1ccccc1CCC(=O)N1CCNCC1Cc1ccccc1 |
| InChI | InChI=1S/C30H35N3O3/c1-23(34)32-29(21-25-12-6-3-7-13-25)36-28-15-9-8-14-26(28)16-17-30(35)33-19-18-31-22-27(33)20-24-10-4-2-5-11-24/h2-15,27,29,31H,16-22H2,1H3,(H,32,34) |
| InChIKey | UWCAFNUDHGFHFA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|