C22H34N4O4 — CID 68669102
phthalate;bis(2,3,4,4-tetramethyl-1,5-dihydroimidazol-3-ium) (PubChem CID 68669102) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is phthalate;bis(2,3,4,4-tetramethyl-1,5-dihydroimidazol-3-ium).
| Compound Name | phthalate;bis(2,3,4,4-tetramethyl-1,5-dihydroimidazol-3-ium) |
|---|---|
| PubChem CID | 68669102 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | phthalate;bis(2,3,4,4-tetramethyl-1,5-dihydroimidazol-3-ium) |
| SMILES | CC1=[N+](C)C(C)(C)CN1.CC1=[N+](C)C(C)(C)CN1.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C7H14N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-6-8-5-7(2,3)9(6)4/h1-4H,(H,9,10)(H,11,12);2*5H2,1-4H3 |
| InChIKey | IQIMUOXRRGJDNG-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|