About 2-N-methylcyclohex-4-ene-1,2-dicarboxamide
2-N-methylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 68669248) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-N-methylcyclohex-4-ene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-methylcyclohex-4-ene-1,2-dicarboxamide |
| PubChem CID | 68669248 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 2-N-methylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | CNC(=O)C1CC=CCC1C(N)=O |
| InChI | InChI=1S/C9H14N2O2/c1-11-9(13)7-5-3-2-4-6(7)8(10)12/h2-3,6-7H,4-5H2,1H3,(H2,10,12)(H,11,13) |
| InChIKey | XGUYLACMEUHWHH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-methylcyclohex-4-ene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methylcyclohex-4-ene-1,2-dicarboxamide?
The IUPAC name of 2-N-methylcyclohex-4-ene-1,2-dicarboxamide (CID 68669248) is 2-N-methylcyclohex-4-ene-1,2-dicarboxamide.
What is the SMILES notation for 2-N-methylcyclohex-4-ene-1,2-dicarboxamide?
The canonical SMILES for 2-N-methylcyclohex-4-ene-1,2-dicarboxamide is CNC(=O)C1CC=CCC1C(N)=O.
What is the InChIKey of 2-N-methylcyclohex-4-ene-1,2-dicarboxamide?
The InChIKey is XGUYLACMEUHWHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-11-9(13)7-5-3-2-4-6(7)8(10)12/h2-3,6-7H,4-5H2,1H3,(H2,10,12)(H,11,13).
What are the key properties of 2-N-methylcyclohex-4-ene-1,2-dicarboxamide?
2-N-methylcyclohex-4-ene-1,2-dicarboxamide has a molecular weight of 182.22 g/mol, XLogP of -0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methylcyclohex-4-ene-1,2-dicarboxamide is sourced from PubChem (CID 68669248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).