C28H37N3O4 — CID 68669377
ethyl 6-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]acetyl]amino]pyridine-3-carboxylate (PubChem CID 68669377) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is ethyl 6-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]acetyl]amino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]acetyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68669377 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | ethyl 6-[[2-[(1R,3aS,3bS,5aR,9aR,9bS,11aR)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl]acetyl]amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@H]2CC[C@H]3[C@@H]4CC[C@H]5NC(=O)C=C[C@]5(C)[C@H]4CC[C@]23C)nc1 |
| InChI | InChI=1S/C28H37N3O4/c1-4-35-26(34)17-5-10-23(29-16-17)31-25(33)15-18-6-8-20-19-7-9-22-28(3,14-12-24(32)30-22)21(19)11-13-27(18,20)2/h5,10,12,14,16,18-22H,4,6-9,11,13,15H2,1-3H3,(H,30,32)(H,29,31,33)/t18-,19+,20+,21+,22-,27-,28-/m1/s1 |
| InChIKey | ZEKMKXYUSLSDFA-DBAMYQSNSA-N |
| XLogP | 4.50 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |