About 7H-purin-2-amine;7H-purin-6-amine
7H-purin-2-amine;7H-purin-6-amine (PubChem CID 68669477) has the molecular formula C10H10N10
and a molecular weight of 270.26 g/mol. Its IUPAC name is 7H-purin-2-amine;7H-purin-6-amine.
Molecular Properties
| Compound Name | 7H-purin-2-amine;7H-purin-6-amine |
| PubChem CID | 68669477 |
| Molecular Formula | C10H10N10 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 7H-purin-2-amine;7H-purin-6-amine |
| SMILES | Nc1ncc2[nH]cnc2n1.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/2C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4;6-5-7-1-3-4(10-5)9-2-8-3/h2*1-2H,(H3,6,7,8,9,10) |
| InChIKey | AAEDGYVTILCLMU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7H-purin-2-amine;7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purin-2-amine;7H-purin-6-amine?
The IUPAC name of 7H-purin-2-amine;7H-purin-6-amine (CID 68669477) is 7H-purin-2-amine;7H-purin-6-amine.
What is the SMILES notation for 7H-purin-2-amine;7H-purin-6-amine?
The canonical SMILES for 7H-purin-2-amine;7H-purin-6-amine is Nc1ncc2[nH]cnc2n1.Nc1ncnc2nc[nH]c12.
What is the InChIKey of 7H-purin-2-amine;7H-purin-6-amine?
The InChIKey is AAEDGYVTILCLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4;6-5-7-1-3-4(10-5)9-2-8-3/h2*1-2H,(H3,6,7,8,9,10).
What are the key properties of 7H-purin-2-amine;7H-purin-6-amine?
7H-purin-2-amine;7H-purin-6-amine has a molecular weight of 270.26 g/mol, XLogP of -0.13, 0 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purin-2-amine;7H-purin-6-amine is sourced from PubChem (CID 68669477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).