About 2-prop-2-enylporphyrin
2-prop-2-enylporphyrin (PubChem CID 68670588) has the molecular formula C23H16N4
and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-prop-2-enylporphyrin.
Molecular Properties
| Compound Name | 2-prop-2-enylporphyrin |
| PubChem CID | 68670588 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-prop-2-enylporphyrin |
| SMILES | C=CCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C23H16N4/c1-2-3-15-10-22-13-20-7-6-18(25-20)11-16-4-5-17(24-16)12-19-8-9-21(26-19)14-23(15)27-22/h2,4-14H,1,3H2/b16-11-,17-12-,18-11-,19-12-,20-13-,21-14-,22-13-,23-14- |
| InChIKey | HKSVKSUWBIEORE-BBFAQAKDSA-N |
| XLogP | 4.53 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylporphyrin?
The IUPAC name of 2-prop-2-enylporphyrin (CID 68670588) is 2-prop-2-enylporphyrin.
What is the SMILES notation for 2-prop-2-enylporphyrin?
The canonical SMILES for 2-prop-2-enylporphyrin is C=CCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-prop-2-enylporphyrin?
The InChIKey is HKSVKSUWBIEORE-BBFAQAKDSA-N. The full InChI is InChI=1S/C23H16N4/c1-2-3-15-10-22-13-20-7-6-18(25-20)11-16-4-5-17(24-16)12-19-8-9-21(26-19)14-23(15)27-22/h2,4-14H,1,3H2/b16-11-,17-12-,18-11-,19-12-,20-13-,21-14-,22-13-,23-14-.
What are the key properties of 2-prop-2-enylporphyrin?
2-prop-2-enylporphyrin has a molecular weight of 348.41 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylporphyrin is sourced from PubChem (CID 68670588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).