C11H18BN3O4 — CID 68670616
[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid (PubChem CID 68670616) has the molecular formula C11H18BN3O4 and a molecular weight of 267.09 g/mol. Its IUPAC name is [1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid.
| Compound Name | [1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68670616 |
| Molecular Formula | C11H18BN3O4 |
| Molecular Weight | 267.09 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | [1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]carbamic acid |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)c(NC(=O)O)n1 |
| InChI | InChI=1S/C11H18BN3O4/c1-10(2)11(3,4)19-12(18-10)7-6-15(5)14-8(7)13-9(16)17/h6H,1-5H3,(H,13,14)(H,16,17) |
| InChIKey | RSVAUDJLOFHOKP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.09 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|