C42H45N3O7S — CID 68670891
tert-butyl 3-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyrazole-1-carboxylate (PubChem CID 68670891) has the molecular formula C42H45N3O7S and a molecular weight of 735.90 g/mol. Its IUPAC name is tert-butyl 3-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 68670891 |
| Molecular Formula | C42H45N3O7S |
| Molecular Weight | 735.90 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | tert-butyl 3-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(NC(=O)C(=C[C@H]2CCC3(C2)O[C@H](c2ccccc2)[C@@H](c2ccccc2)O3)c2ccc(S(=O)(=O)C3CC3)c(C3CC3)c2)n1 |
| InChI | InChI=1S/C42H45N3O7S/c1-41(2,3)52-40(47)45-23-21-36(44-45)43-39(46)34(31-16-19-35(33(25-31)28-14-15-28)53(48,49)32-17-18-32)24-27-20-22-42(26-27)50-37(29-10-6-4-7-11-29)38(51-42)30-12-8-5-9-13-30/h4-13,16,19,21,23-25,27-28,32,37-38H,14-15,17-18,20,22,26H2,1-3H3,(H,43,44,46)/t27-,37-,38-/m1/s1 |
| InChIKey | CYLCGIDKSNAGGC-POXJXICBSA-N |
| XLogP | 8.53 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.90 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|