C40H38N2O7S — CID 68670984
6-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyridine-3-carboxylic acid (PubChem CID 68670984) has the molecular formula C40H38N2O7S and a molecular weight of 690.82 g/mol. Its IUPAC name is 6-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 68670984 |
| Molecular Formula | C40H38N2O7S |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | 6-[[2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-3-[(2R,3R,8S)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]prop-2-enoyl]amino]pyridine-3-carboxylic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)cn1)C(=C[C@H]1CCC2(C1)O[C@H](c1ccccc1)[C@@H](c1ccccc1)O2)c1ccc(S(=O)(=O)C2CC2)c(C2CC2)c1 |
| InChI | InChI=1S/C40H38N2O7S/c43-38(42-35-18-14-30(24-41-35)39(44)45)33(29-13-17-34(32(22-29)26-11-12-26)50(46,47)31-15-16-31)21-25-19-20-40(23-25)48-36(27-7-3-1-4-8-27)37(49-40)28-9-5-2-6-10-28/h1-10,13-14,17-18,21-22,24-26,31,36-37H,11-12,15-16,19-20,23H2,(H,44,45)(H,41,42,43)/t25-,36-,37-/m1/s1 |
| InChIKey | CJWBVEYYLFYIGU-LTXVMEGZSA-N |
| XLogP | 7.64 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|