About 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine
5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine (PubChem CID 68671320) has the molecular formula C33H25F2N3
and a molecular weight of 501.58 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine.
Molecular Properties
| Compound Name | 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine |
| PubChem CID | 68671320 |
| Molecular Formula | C33H25F2N3 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine |
| SMILES | Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(Cc3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C33H25F2N3/c34-28-19-24(20-29(35)22-28)18-23-16-17-31-30(21-23)32(36)37-38(31)33(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-17,19-22H,18H2,(H2,36,37) |
| InChIKey | PUVIZKQLGDWRLB-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine?
The IUPAC name of 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine (CID 68671320) is 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine.
What is the SMILES notation for 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine?
The canonical SMILES for 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine is Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(Cc3cc(F)cc(F)c3)cc12.
What is the InChIKey of 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine?
The InChIKey is PUVIZKQLGDWRLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H25F2N3/c34-28-19-24(20-29(35)22-28)18-23-16-17-31-30(21-23)32(36)37-38(31)33(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-17,19-22H,18H2,(H2,36,37).
What are the key properties of 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine?
5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine has a molecular weight of 501.58 g/mol, XLogP of 7.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-amine is sourced from PubChem (CID 68671320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).