C50H44F3N5O2 — CID 68671687
N-[5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-yl]-2-fluoro-5-[2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]benzamide (PubChem CID 68671687) has the molecular formula C50H44F3N5O2 and a molecular weight of 803.93 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-yl]-2-fluoro-5-[2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]benzamide.
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-yl]-2-fluoro-5-[2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 68671687 |
| Molecular Formula | C50H44F3N5O2 |
| Molecular Weight | 803.93 g/mol |
| Exact Mass | 803.34 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]-1-tritylindazol-3-yl]-2-fluoro-5-[2-(pyrrolidin-1-ylmethyl)pyrrolidine-1-carbonyl]benzamide |
| SMILES | O=C(Nc1nn(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(Cc3cc(F)cc(F)c3)cc12)c1cc(C(=O)N2CCCC2CN2CCCC2)ccc1F |
| InChI | InChI=1S/C50H44F3N5O2/c51-40-28-35(29-41(52)32-40)27-34-20-23-46-44(30-34)47(55-58(46)50(37-13-4-1-5-14-37,38-15-6-2-7-16-38)39-17-8-3-9-18-39)54-48(59)43-31-36(21-22-45(43)53)49(60)57-26-12-19-42(57)33-56-24-10-11-25-56/h1-9,13-18,20-23,28-32,42H,10-12,19,24-27,33H2,(H,54,55,59) |
| InChIKey | VPRKUFOPIDTBKU-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.93 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|