About 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid
4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid (PubChem CID 68671817) has the molecular formula C22H15F2N3O3
and a molecular weight of 407.38 g/mol. Its IUPAC name is 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid |
| PubChem CID | 68671817 |
| Molecular Formula | C22H15F2N3O3 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)Nc2n[nH]c3ccc(Cc4cc(F)cc(F)c4)cc23)cc1 |
| InChI | InChI=1S/C22H15F2N3O3/c23-16-8-13(9-17(24)11-16)7-12-1-6-19-18(10-12)20(27-26-19)25-21(28)14-2-4-15(5-3-14)22(29)30/h1-6,8-11H,7H2,(H,29,30)(H2,25,26,27,28) |
| InChIKey | PDPNLWLYEOGPRP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid?
The IUPAC name of 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid (CID 68671817) is 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid.
What is the SMILES notation for 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid?
The canonical SMILES for 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid is O=C(O)c1ccc(C(=O)Nc2n[nH]c3ccc(Cc4cc(F)cc(F)c4)cc23)cc1.
What is the InChIKey of 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid?
The InChIKey is PDPNLWLYEOGPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F2N3O3/c23-16-8-13(9-17(24)11-16)7-12-1-6-19-18(10-12)20(27-26-19)25-21(28)14-2-4-15(5-3-14)22(29)30/h1-6,8-11H,7H2,(H,29,30)(H2,25,26,27,28).
What are the key properties of 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid?
4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid has a molecular weight of 407.38 g/mol, XLogP of 4.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamoyl]benzoic acid is sourced from PubChem (CID 68671817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).