C29H28N2O7S2 — CID 68671904
4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-methyl-1-(4-methyl-N-sulfinoanilino)benzene (PubChem CID 68671904) has the molecular formula C29H28N2O7S2 and a molecular weight of 580.68 g/mol. Its IUPAC name is 4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-methyl-1-(4-methyl-N-sulfinoanilino)benzene.
| Compound Name | 4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-methyl-1-(4-methyl-N-sulfinoanilino)benzene |
|---|---|
| PubChem CID | 68671904 |
| Molecular Formula | C29H28N2O7S2 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 4-[3-methoxycarbonyl-4-(4-methyl-N-sulfinoanilino)phenoxy]-2-methyl-1-(4-methyl-N-sulfinoanilino)benzene |
| SMILES | COC(=O)c1cc(Oc2ccc(N(c3ccc(C)cc3)S(=O)O)c(C)c2)ccc1N(c1ccc(C)cc1)S(=O)O |
| InChI | InChI=1S/C29H28N2O7S2/c1-19-5-9-22(10-6-19)30(39(33)34)27-15-13-24(17-21(27)3)38-25-14-16-28(26(18-25)29(32)37-4)31(40(35)36)23-11-7-20(2)8-12-23/h5-18H,1-4H3,(H,33,34)(H,35,36) |
| InChIKey | PUOBADQIRDGCDN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|