C16H24BNO4 — CID 68671964
[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]oxetan-3-yl]methanamine (PubChem CID 68671964) has the molecular formula C16H24BNO4 and a molecular weight of 305.18 g/mol. Its IUPAC name is [3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]oxetan-3-yl]methanamine.
| Compound Name | [3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]oxetan-3-yl]methanamine |
|---|---|
| PubChem CID | 68671964 |
| Molecular Formula | C16H24BNO4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | [3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]oxetan-3-yl]methanamine |
| SMILES | CC1(C)OB(c2ccc(OC3(CN)COC3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H24BNO4/c1-14(2)15(3,4)22-17(21-14)12-5-7-13(8-6-12)20-16(9-18)10-19-11-16/h5-8H,9-11,18H2,1-4H3 |
| InChIKey | XJLWCFNTBRBCTR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|