About 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate
1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate (PubChem CID 68672176) has the molecular formula C21H22ClFN4O2
and a molecular weight of 416.88 g/mol. Its IUPAC name is 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate.
Molecular Properties
| Compound Name | 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate |
| PubChem CID | 68672176 |
| Molecular Formula | C21H22ClFN4O2 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate |
| SMILES | CN1CCCCC1C(NC(=O)Oc1ccc2[nH]ncc2c1)c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C21H22ClFN4O2/c1-27-7-3-2-4-19(27)20(13-8-15(22)11-16(23)9-13)25-21(28)29-17-5-6-18-14(10-17)12-24-26-18/h5-6,8-12,19-20H,2-4,7H2,1H3,(H,24,26)(H,25,28) |
| InChIKey | RCOFTTWHZYPIAT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate?
The IUPAC name of 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate (CID 68672176) is 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate.
What is the SMILES notation for 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate?
The canonical SMILES for 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate is CN1CCCCC1C(NC(=O)Oc1ccc2[nH]ncc2c1)c1cc(F)cc(Cl)c1.
What is the InChIKey of 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate?
The InChIKey is RCOFTTWHZYPIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClFN4O2/c1-27-7-3-2-4-19(27)20(13-8-15(22)11-16(23)9-13)25-21(28)29-17-5-6-18-14(10-17)12-24-26-18/h5-6,8-12,19-20H,2-4,7H2,1H3,(H,24,26)(H,25,28).
What are the key properties of 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate?
1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate has a molecular weight of 416.88 g/mol, XLogP of 4.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-5-yl N-[(3-chloro-5-fluorophenyl)-(1-methylpiperidin-2-yl)methyl]carbamate is sourced from PubChem (CID 68672176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).