C8H13N3 — CID 68672357
2-methyl-2,3,5,6,7,8-hexahydroimidazo[4,5-d]azepine (PubChem CID 68672357) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-2,3,5,6,7,8-hexahydroimidazo[4,5-d]azepine.
| Compound Name | 2-methyl-2,3,5,6,7,8-hexahydroimidazo[4,5-d]azepine |
|---|---|
| PubChem CID | 68672357 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-methyl-2,3,5,6,7,8-hexahydroimidazo[4,5-d]azepine |
| SMILES | CC1N=C2CCNCC=C2N1 |
| InChI | InChI=1S/C8H13N3/c1-6-10-7-2-4-9-5-3-8(7)11-6/h2,6,9-10H,3-5H2,1H3 |
| InChIKey | IDUKPYHBNIZMAH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |