About (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine
(S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine (PubChem CID 68673281) has the molecular formula C15H20Cl2N2
and a molecular weight of 299.25 g/mol. Its IUPAC name is (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine.
Molecular Properties
| Compound Name | (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine |
| PubChem CID | 68673281 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine |
| SMILES | C=CCN1CCCC[C@H]1[C@@H](N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2/c1-2-6-19-7-4-3-5-14(19)15(18)11-8-12(16)10-13(17)9-11/h2,8-10,14-15H,1,3-7,18H2/t14-,15-/m0/s1 |
| InChIKey | TWOXIFQYIDUHTG-GJZGRUSLSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine?
The IUPAC name of (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine (CID 68673281) is (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine.
What is the SMILES notation for (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine?
The canonical SMILES for (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine is C=CCN1CCCC[C@H]1[C@@H](N)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine?
The InChIKey is TWOXIFQYIDUHTG-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H20Cl2N2/c1-2-6-19-7-4-3-5-14(19)15(18)11-8-12(16)10-13(17)9-11/h2,8-10,14-15H,1,3-7,18H2/t14-,15-/m0/s1.
What are the key properties of (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine?
(S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine has a molecular weight of 299.25 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(3,5-dichlorophenyl)-[(2S)-1-prop-2-enylpiperidin-2-yl]methanamine is sourced from PubChem (CID 68673281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).