C9H10ClNOS — CID 68673304
3-(5-chlorothiophen-2-yl)-N,N-dimethylprop-2-enamide (PubChem CID 68673304) has the molecular formula C9H10ClNOS and a molecular weight of 215.71 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 68673304 |
| Molecular Formula | C9H10ClNOS |
| Molecular Weight | 215.71 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C=Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H10ClNOS/c1-11(2)9(12)6-4-7-3-5-8(10)13-7/h3-6H,1-2H3 |
| InChIKey | DQWIPJAFWHTIDC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.71 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|