C29H36N4O4 — CID 68673419
1-ethyl-3,3,5-trimethyl-7-[3-[(5-methylfuran-2-yl)methyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 68673419) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[(5-methylfuran-2-yl)methyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(5-methylfuran-2-yl)methyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673419 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(5-methylfuran-2-yl)methyl-(pyridin-4-ylmethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(Cc3ccncc3)Cc3ccc(C)o3)ccc21 |
| InChI | InChI=1S/C29H36N4O4/c1-6-33-25-11-10-23(18-26(25)31(5)27(34)29(3,4)28(33)35)36-17-7-16-32(19-22-12-14-30-15-13-22)20-24-9-8-21(2)37-24/h8-15,18H,6-7,16-17,19-20H2,1-5H3 |
| InChIKey | LZLRTKXEIIWULM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|