C35H43Cl2N5O5 — CID 68673469
1-ethyl-7-[3-[2-(6-methoxy-2-oxoquinolin-1-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione;dihydrochloride (PubChem CID 68673469) has the molecular formula C35H43Cl2N5O5 and a molecular weight of 684.67 g/mol. Its IUPAC name is 1-ethyl-7-[3-[2-(6-methoxy-2-oxoquinolin-1-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione;dihydrochloride.
| Compound Name | 1-ethyl-7-[3-[2-(6-methoxy-2-oxoquinolin-1-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 68673469 |
| Molecular Formula | C35H43Cl2N5O5 |
| Molecular Weight | 684.67 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 1-ethyl-7-[3-[2-(6-methoxy-2-oxoquinolin-1-yl)ethyl-(pyridin-4-ylmethyl)amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCn3c(=O)ccc4cc(OC)ccc43)Cc3ccncc3)ccc21.Cl.Cl |
| InChI | InChI=1S/C35H41N5O5.2ClH/c1-6-39-30-12-10-28(23-31(30)37(4)33(42)35(2,3)34(39)43)45-21-7-18-38(24-25-14-16-36-17-15-25)19-20-40-29-11-9-27(44-5)22-26(29)8-13-32(40)41;;/h8-17,22-23H,6-7,18-21,24H2,1-5H3;2*1H |
| InChIKey | IVZPOKTUULOARG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 97.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|