About [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine
[1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine (PubChem CID 68673528) has the molecular formula C19H21F2N
and a molecular weight of 301.38 g/mol. Its IUPAC name is [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine |
| PubChem CID | 68673528 |
| Molecular Formula | C19H21F2N |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine |
| SMILES | NCC1(c2ccc(-c3cc(F)cc(F)c3)cc2)CCCCC1 |
| InChI | InChI=1S/C19H21F2N/c20-17-10-15(11-18(21)12-17)14-4-6-16(7-5-14)19(13-22)8-2-1-3-9-19/h4-7,10-12H,1-3,8-9,13,22H2 |
| InChIKey | ZQMRVZGOHLYXDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine?
The IUPAC name of [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine (CID 68673528) is [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine.
What is the SMILES notation for [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine?
The canonical SMILES for [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine is NCC1(c2ccc(-c3cc(F)cc(F)c3)cc2)CCCCC1.
What is the InChIKey of [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine?
The InChIKey is ZQMRVZGOHLYXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N/c20-17-10-15(11-18(21)12-17)14-4-6-16(7-5-14)19(13-22)8-2-1-3-9-19/h4-7,10-12H,1-3,8-9,13,22H2.
What are the key properties of [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine?
[1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine has a molecular weight of 301.38 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(3,5-difluorophenyl)phenyl]cyclohexyl]methanamine is sourced from PubChem (CID 68673528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).