C34H43Cl2N5O5 — CID 68673907
1-ethyl-3,3,5-trimethyl-7-[4-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]butoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride (PubChem CID 68673907) has the molecular formula C34H43Cl2N5O5 and a molecular weight of 672.65 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[4-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]butoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[4-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]butoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
|---|---|
| PubChem CID | 68673907 |
| Molecular Formula | C34H43Cl2N5O5 |
| Molecular Weight | 672.65 g/mol |
| Exact Mass | 671.26 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[4-[(2-methyl-3-pyridinyl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]butoxy]-1,5-benzodiazepine-2,4-dione;dihydrochloride |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCCN(CCn3ccc4occc4c3=O)Cc3cccnc3C)ccc21.Cl.Cl |
| InChI | InChI=1S/C34H41N5O5.2ClH/c1-6-39-28-12-11-26(22-29(28)36(5)32(41)34(3,4)33(39)42)43-20-8-7-16-37(23-25-10-9-15-35-24(25)2)18-19-38-17-13-30-27(31(38)40)14-21-44-30;;/h9-15,17,21-22H,6-8,16,18-20,23H2,1-5H3;2*1H |
| InChIKey | PIYWUEQLQBXVSK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 101.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|