About 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol
4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol (PubChem CID 68673922) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.24 g/mol. Its IUPAC name is 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol |
| PubChem CID | 68673922 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol |
| SMILES | CCC1(O)CCC(CN)(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-2-15(19)7-5-14(10-18,6-8-15)11-3-4-12(16)13(17)9-11/h3-4,9,19H,2,5-8,10,18H2,1H3 |
| InChIKey | LZGLGBOOTDKOQF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol?
The IUPAC name of 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol (CID 68673922) is 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol.
What is the SMILES notation for 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol?
The canonical SMILES for 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol is CCC1(O)CCC(CN)(c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol?
The InChIKey is LZGLGBOOTDKOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-2-15(19)7-5-14(10-18,6-8-15)11-3-4-12(16)13(17)9-11/h3-4,9,19H,2,5-8,10,18H2,1H3.
What are the key properties of 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol?
4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol has a molecular weight of 302.24 g/mol, XLogP of 3.90, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-4-(3,4-dichlorophenyl)-1-ethylcyclohexan-1-ol is sourced from PubChem (CID 68673922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).