About 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid
8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid (PubChem CID 68673930) has the molecular formula C12H10N2O4
and a molecular weight of 246.22 g/mol. Its IUPAC name is 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid |
| PubChem CID | 68673930 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid |
| SMILES | COc1ccc2c(c1)-c1n[nH]c(C(=O)O)c1CO2 |
| InChI | InChI=1S/C12H10N2O4/c1-17-6-2-3-9-7(4-6)10-8(5-18-9)11(12(15)16)14-13-10/h2-4H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | CORLJUSTFFKTFP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name of 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid (CID 68673930) is 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid.
What is the SMILES notation for 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES for 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid is COc1ccc2c(c1)-c1n[nH]c(C(=O)O)c1CO2.
What is the InChIKey of 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is CORLJUSTFFKTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O4/c1-17-6-2-3-9-7(4-6)10-8(5-18-9)11(12(15)16)14-13-10/h2-4H,5H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid?
8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid has a molecular weight of 246.22 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,4-dihydrochromeno[4,3-c]pyrazole-3-carboxylic acid is sourced from PubChem (CID 68673930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).