C35H39FN4O4 — CID 68673982
1-ethyl-7-[3-[(3-fluorophenyl)methyl-[2-(1-oxoisoquinolin-2-yl)ethyl]amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 68673982) has the molecular formula C35H39FN4O4 and a molecular weight of 598.72 g/mol. Its IUPAC name is 1-ethyl-7-[3-[(3-fluorophenyl)methyl-[2-(1-oxoisoquinolin-2-yl)ethyl]amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-[3-[(3-fluorophenyl)methyl-[2-(1-oxoisoquinolin-2-yl)ethyl]amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68673982 |
| Molecular Formula | C35H39FN4O4 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 1-ethyl-7-[3-[(3-fluorophenyl)methyl-[2-(1-oxoisoquinolin-2-yl)ethyl]amino]propoxy]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCn3ccc4ccccc4c3=O)Cc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C35H39FN4O4/c1-5-40-30-15-14-28(23-31(30)37(4)33(42)35(2,3)34(40)43)44-21-9-17-38(24-25-10-8-12-27(36)22-25)19-20-39-18-16-26-11-6-7-13-29(26)32(39)41/h6-8,10-16,18,22-23H,5,9,17,19-21,24H2,1-4H3 |
| InChIKey | RMPOXPRODWZHJB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|