C31H39N5O3 — CID 68674100
1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-4-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 68674100) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-4-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-4-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68674100 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[3-[(2-methyl-4-pyridinyl)methyl-(2-pyridin-3-ylethyl)amino]propoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCc3cccnc3)Cc3ccnc(C)c3)ccc21 |
| InChI | InChI=1S/C31H39N5O3/c1-6-36-27-11-10-26(20-28(27)34(5)29(37)31(3,4)30(36)38)39-18-8-16-35(17-13-24-9-7-14-32-21-24)22-25-12-15-33-23(2)19-25/h7,9-12,14-15,19-21H,6,8,13,16-18,22H2,1-5H3 |
| InChIKey | WZHCQCZEKDDJPQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|