C33H38ClN5O5 — CID 68674269
7-[3-[(5-chloro-2-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 68674269) has the molecular formula C33H38ClN5O5 and a molecular weight of 620.15 g/mol. Its IUPAC name is 7-[3-[(5-chloro-2-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[3-[(5-chloro-2-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68674269 |
| Molecular Formula | C33H38ClN5O5 |
| Molecular Weight | 620.15 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 7-[3-[(5-chloro-2-pyridinyl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCn3ccc4oc(C)cc4c3=O)Cc3ccc(Cl)cn3)ccc21 |
| InChI | InChI=1S/C33H38ClN5O5/c1-6-39-27-11-10-25(19-28(27)36(5)31(41)33(3,4)32(39)42)43-17-7-13-37(21-24-9-8-23(34)20-35-24)15-16-38-14-12-29-26(30(38)40)18-22(2)44-29/h8-12,14,18-20H,6-7,13,15-17,21H2,1-5H3 |
| InChIKey | YXKQGPUWYJVYQX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 101.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|