About (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride
(1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride (PubChem CID 68674284) has the molecular formula C15H22ClNOS
and a molecular weight of 299.87 g/mol. Its IUPAC name is (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride |
| PubChem CID | 68674284 |
| Molecular Formula | C15H22ClNOS |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride |
| SMILES | COc1ccc(CSC2C[C@H]3CC[C@@H](C2)N3)cc1.Cl |
| InChI | InChI=1S/C15H21NOS.ClH/c1-17-14-6-2-11(3-7-14)10-18-15-8-12-4-5-13(9-15)16-12;/h2-3,6-7,12-13,15-16H,4-5,8-10H2,1H3;1H/t12-,13+,15?; |
| InChIKey | OWISMTNJXIPGJQ-HLRVCSOFSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride?
The IUPAC name of (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride (CID 68674284) is (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride.
What is the SMILES notation for (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride?
The canonical SMILES for (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride is COc1ccc(CSC2C[C@H]3CC[C@@H](C2)N3)cc1.Cl.
What is the InChIKey of (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride?
The InChIKey is OWISMTNJXIPGJQ-HLRVCSOFSA-N. The full InChI is InChI=1S/C15H21NOS.ClH/c1-17-14-6-2-11(3-7-14)10-18-15-8-12-4-5-13(9-15)16-12;/h2-3,6-7,12-13,15-16H,4-5,8-10H2,1H3;1H/t12-,13+,15?;.
What are the key properties of (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride?
(1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride has a molecular weight of 299.87 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-[(4-methoxyphenyl)methylsulfanyl]-8-azabicyclo[3.2.1]octane;hydrochloride is sourced from PubChem (CID 68674284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).