About trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol
trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol (PubChem CID 68674581) has the molecular formula C12H15Cl2NO
and a molecular weight of 260.16 g/mol. Its IUPAC name is trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol |
| PubChem CID | 68674581 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol |
| SMILES | NC[C@@]1(c2ccc(Cl)c(Cl)c2)CC[C@H](O)C1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-10-2-1-8(5-11(10)14)12(7-15)4-3-9(16)6-12/h1-2,5,9,16H,3-4,6-7,15H2/t9-,12+/m0/s1 |
| InChIKey | ACEHPFMVELBCNI-JOYOIKCWSA-N |
| XLogP | 2.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol?
The IUPAC name of trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol (CID 68674581) is trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol.
What is the SMILES notation for trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol?
The canonical SMILES for trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol is NC[C@@]1(c2ccc(Cl)c(Cl)c2)CC[C@H](O)C1.
What is the InChIKey of trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol?
The InChIKey is ACEHPFMVELBCNI-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H15Cl2NO/c13-10-2-1-8(5-11(10)14)12(7-15)4-3-9(16)6-12/h1-2,5,9,16H,3-4,6-7,15H2/t9-,12+/m0/s1.
What are the key properties of trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol?
trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol has a molecular weight of 260.16 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-3-(aminomethyl)-3-(3,4-dichlorophenyl)cyclopentan-1-ol is sourced from PubChem (CID 68674581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).