C32H38N4O4 — CID 68674673
N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-2-methyl-N-(2-pyridin-3-ylethyl)benzamide (PubChem CID 68674673) has the molecular formula C32H38N4O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-2-methyl-N-(2-pyridin-3-ylethyl)benzamide.
| Compound Name | N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-2-methyl-N-(2-pyridin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 68674673 |
| Molecular Formula | C32H38N4O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | N-[3-[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)oxy]propyl]-2-methyl-N-(2-pyridin-3-ylethyl)benzamide |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN(CCc3cccnc3)C(=O)c3ccccc3C)ccc21 |
| InChI | InChI=1S/C32H38N4O4/c1-6-36-27-15-14-25(21-28(27)34(5)30(38)32(3,4)31(36)39)40-20-10-18-35(19-16-24-12-9-17-33-22-24)29(37)26-13-8-7-11-23(26)2/h7-9,11-15,17,21-22H,6,10,16,18-20H2,1-5H3 |
| InChIKey | PVLGXGLEOULTOX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|