C15H20N2O3 — CID 68674859
5-ethyl-7-methoxy-1,3,3-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 68674859) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-ethyl-7-methoxy-1,3,3-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 5-ethyl-7-methoxy-1,3,3-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68674859 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5-ethyl-7-methoxy-1,3,3-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C15H20N2O3/c1-6-17-12-9-10(20-5)7-8-11(12)16(4)13(18)15(2,3)14(17)19/h7-9H,6H2,1-5H3 |
| InChIKey | PZTAQVIKALRFSG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|