About tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate
tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 68675101) has the molecular formula C19H25BrFNO3
and a molecular weight of 414.32 g/mol. Its IUPAC name is tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 68675101 |
| Molecular Formula | C19H25BrFNO3 |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(OCc1c(F)cccc1Br)C2 |
| InChI | InChI=1S/C19H25BrFNO3/c1-19(2,3)25-18(23)22-12-7-8-13(22)10-14(9-12)24-11-15-16(20)5-4-6-17(15)21/h4-6,12-14H,7-11H2,1-3H3/t12-,13+,14? |
| InChIKey | AHDHCMVBBFQLNX-PBWFPOADSA-N |
| XLogP | 5.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 68675101) is tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate is CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(OCc1c(F)cccc1Br)C2.
What is the InChIKey of tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is AHDHCMVBBFQLNX-PBWFPOADSA-N. The full InChI is InChI=1S/C19H25BrFNO3/c1-19(2,3)25-18(23)22-12-7-8-13(22)10-14(9-12)24-11-15-16(20)5-4-6-17(15)21/h4-6,12-14H,7-11H2,1-3H3/t12-,13+,14?.
What are the key properties of tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate?
tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 414.32 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1R,5S)-3-[(2-bromo-6-fluorophenyl)methoxy]-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 68675101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).