About 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin
12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin (PubChem CID 68675123) has the molecular formula C25H20N6
and a molecular weight of 404.48 g/mol. Its IUPAC name is 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin.
Molecular Properties
| Compound Name | 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin |
| PubChem CID | 68675123 |
| Molecular Formula | C25H20N6 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin |
| SMILES | CCC1=C2/C=C3/C=CC(=N3)/C=c3/cc/c([nH]3)=C/C3=N/C(=C\C(=N2)C1=C1NC=CN1)C=C3 |
| InChI | InChI=1S/C25H20N6/c1-2-21-22-13-19-7-5-17(29-19)11-15-3-4-16(28-15)12-18-6-8-20(30-18)14-23(31-22)24(21)25-26-9-10-27-25/h3-14,26-28H,2H2,1H3/b15-11-,16-12-,19-13-,20-14- |
| InChIKey | DGTNKUFUQDWUKZ-HRPILDGQSA-N |
| XLogP | 2.37 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin?
The IUPAC name of 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin (CID 68675123) is 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin.
What is the SMILES notation for 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin?
The canonical SMILES for 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin is CCC1=C2/C=C3/C=CC(=N3)/C=c3/cc/c([nH]3)=C/C3=N/C(=C\C(=N2)C1=C1NC=CN1)C=C3.
What is the InChIKey of 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin?
The InChIKey is DGTNKUFUQDWUKZ-HRPILDGQSA-N. The full InChI is InChI=1S/C25H20N6/c1-2-21-22-13-19-7-5-17(29-19)11-15-3-4-16(28-15)12-18-6-8-20(30-18)14-23(31-22)24(21)25-26-9-10-27-25/h3-14,26-28H,2H2,1H3/b15-11-,16-12-,19-13-,20-14-.
What are the key properties of 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin?
12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin has a molecular weight of 404.48 g/mol, XLogP of 2.37, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(1,3-dihydroimidazol-2-ylidene)-13-ethyl-21H-porphyrin is sourced from PubChem (CID 68675123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).